C52H33N3S — CID 166024821
2-(3-dibenzothiophen-4-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 166024821) has the molecular formula C52H33N3S and a molecular weight of 736.95 g/mol. Its IUPAC name is 2-(3-dibenzothiophen-4-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2-(3-dibenzothiophen-4-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 166024821 |
| Molecular Formula | C52H33N3S |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 736.27 |
| IUPAC Name | 2-(3-dibenzothiophen-4-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4cccc5c4sc4ccccc45)c3)nc(-c3cccc4c3-c3ccccc3C4(c3ccccc3)c3ccccc3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C52H33N3S/c1-4-17-34(18-5-1)49-53-50(36-20-14-19-35(33-36)39-27-15-28-41-40-25-11-13-32-46(40)56-48(39)41)55-51(54-49)43-29-16-31-45-47(43)42-26-10-12-30-44(42)52(45,37-21-6-2-7-22-37)38-23-8-3-9-24-38/h1-33H/i1D,4D,5D,17D,18D |
| InChIKey | KURISSBEPRPJDI-OCAOJUBNSA-N |
| XLogP | 13.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |