C35H35N — CID 118242606
4-methyl-N-(4-methylphenyl)-N-[(3E,5E)-6-methyl-7-(4-phenylphenyl)octa-1,3,5-trien-3-yl]aniline (PubChem CID 118242606) has the molecular formula C35H35N and a molecular weight of 469.67 g/mol. Its IUPAC name is 4-methyl-N-(4-methylphenyl)-N-[(3E,5E)-6-methyl-7-(4-phenylphenyl)octa-1,3,5-trien-3-yl]aniline.
| Compound Name | 4-methyl-N-(4-methylphenyl)-N-[(3E,5E)-6-methyl-7-(4-phenylphenyl)octa-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 118242606 |
| Molecular Formula | C35H35N |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 4-methyl-N-(4-methylphenyl)-N-[(3E,5E)-6-methyl-7-(4-phenylphenyl)octa-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C(=C\C=C(/C)C(C)c1ccc(-c2ccccc2)cc1)N(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H35N/c1-6-33(36(34-21-12-26(2)13-22-34)35-23-14-27(3)15-24-35)25-16-28(4)29(5)30-17-19-32(20-18-30)31-10-8-7-9-11-31/h6-25,29H,1H2,2-5H3/b28-16+,33-25+ |
| InChIKey | LQOVEBSBHWIVJE-GVOPETASSA-N |
| XLogP | 9.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|