C16H13Br3 — CID 58352111
1,2,3-tribromo-7,9,9-trimethylfluorene (PubChem CID 58352111) has the molecular formula C16H13Br3 and a molecular weight of 444.99 g/mol. Its IUPAC name is 1,2,3-tribromo-7,9,9-trimethylfluorene.
| Compound Name | 1,2,3-tribromo-7,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 58352111 |
| Molecular Formula | C16H13Br3 |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 441.86 |
| IUPAC Name | 1,2,3-tribromo-7,9,9-trimethylfluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1c-2cc(Br)c(Br)c1Br |
| InChI | InChI=1S/C16H13Br3/c1-8-4-5-9-10-7-12(17)14(18)15(19)13(10)16(2,3)11(9)6-8/h4-7H,1-3H3 |
| InChIKey | IGTORSWMVLRWAT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|