C26H26 — CID 142540848
2,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene (PubChem CID 142540848) has the molecular formula C26H26 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene.
| Compound Name | 2,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 142540848 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2,6,6,10,12,12-hexamethylindeno[1,2-b]fluorene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)c1cccc(C)c1-3 |
| InChI | InChI=1S/C26H26/c1-15-10-11-17-18-13-23-19(14-22(18)26(5,6)21(17)12-15)24-16(2)8-7-9-20(24)25(23,3)4/h7-14H,1-6H3 |
| InChIKey | FRHLXJDNCZYDTJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |