C18H18Br2O2 — CID 23150365
2,7-dibromo-9,10-dimethoxy-9,10-dimethylphenanthrene (PubChem CID 23150365) has the molecular formula C18H18Br2O2 and a molecular weight of 426.15 g/mol. Its IUPAC name is 2,7-dibromo-9,10-dimethoxy-9,10-dimethylphenanthrene.
| Compound Name | 2,7-dibromo-9,10-dimethoxy-9,10-dimethylphenanthrene |
|---|---|
| PubChem CID | 23150365 |
| Molecular Formula | C18H18Br2O2 |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 2,7-dibromo-9,10-dimethoxy-9,10-dimethylphenanthrene |
| SMILES | COC1(C)c2cc(Br)ccc2-c2ccc(Br)cc2C1(C)OC |
| InChI | InChI=1S/C18H18Br2O2/c1-17(21-3)15-9-11(19)5-7-13(15)14-8-6-12(20)10-16(14)18(17,2)22-4/h5-10H,1-4H3 |
| InChIKey | NRJGSNJMKWLULL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |