C47H42Br4Si — CID 158874944
bis(7-bromo-9,9-dimethylfluoren-2-yl)-dimethylsilane;2,7-dibromo-9,9-dimethylfluorene (PubChem CID 158874944) has the molecular formula C47H42Br4Si and a molecular weight of 954.55 g/mol. Its IUPAC name is bis(7-bromo-9,9-dimethylfluoren-2-yl)-dimethylsilane;2,7-dibromo-9,9-dimethylfluorene.
| Compound Name | bis(7-bromo-9,9-dimethylfluoren-2-yl)-dimethylsilane;2,7-dibromo-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 158874944 |
| Molecular Formula | C47H42Br4Si |
| Molecular Weight | 954.55 g/mol |
| Exact Mass | 949.98 |
| IUPAC Name | bis(7-bromo-9,9-dimethylfluoren-2-yl)-dimethylsilane;2,7-dibromo-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(Br)ccc2-c2ccc(Br)cc21.CC1(C)c2cc(Br)ccc2-c2ccc([Si](C)(C)c3ccc4c(c3)C(C)(C)c3cc(Br)ccc3-4)cc21 |
| InChI | InChI=1S/C32H30Br2Si.C15H12Br2/c1-31(2)27-15-19(33)7-11-23(27)25-13-9-21(17-29(25)31)35(5,6)22-10-14-26-24-12-8-20(34)16-28(24)32(3,4)30(26)18-22;1-15(2)13-7-9(16)3-5-11(13)12-6-4-10(17)8-14(12)15/h7-18H,1-6H3;3-8H,1-2H3 |
| InChIKey | JCHWIGATXDJJCB-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.55 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|