C26H12Br4Cl2 — CID 101407207
2,7-dibromo-9-chloro-9-(2,7-dibromo-9-chlorofluoren-9-yl)fluorene (PubChem CID 101407207) has the molecular formula C26H12Br4Cl2 and a molecular weight of 714.90 g/mol. Its IUPAC name is 2,7-dibromo-9-chloro-9-(2,7-dibromo-9-chlorofluoren-9-yl)fluorene.
| Compound Name | 2,7-dibromo-9-chloro-9-(2,7-dibromo-9-chlorofluoren-9-yl)fluorene |
|---|---|
| PubChem CID | 101407207 |
| Molecular Formula | C26H12Br4Cl2 |
| Molecular Weight | 714.90 g/mol |
| Exact Mass | 709.70 |
| IUPAC Name | 2,7-dibromo-9-chloro-9-(2,7-dibromo-9-chlorofluoren-9-yl)fluorene |
| SMILES | ClC1(C2(Cl)c3cc(Br)ccc3-c3ccc(Br)cc32)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C26H12Br4Cl2/c27-13-1-5-17-18-6-2-14(28)10-22(18)25(31,21(17)9-13)26(32)23-11-15(29)3-7-19(23)20-8-4-16(30)12-24(20)26/h1-12H |
| InChIKey | OMYZGGFAOVWMAY-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.90 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|