About 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene
2,7-dibromo-9,9-bis(2-bromoethyl)fluorene (PubChem CID 68813933) has the molecular formula C17H14Br4
and a molecular weight of 537.92 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene |
| PubChem CID | 68813933 |
| Molecular Formula | C17H14Br4 |
| Molecular Weight | 537.92 g/mol |
| Exact Mass | 533.78 |
| IUPAC Name | 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene |
| SMILES | BrCCC1(CCBr)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H14Br4/c18-7-5-17(6-8-19)15-9-11(20)1-3-13(15)14-4-2-12(21)10-16(14)17/h1-4,9-10H,5-8H2 |
| InChIKey | XMPMJNYWWVUWLS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.92 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene?
The IUPAC name of 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene (CID 68813933) is 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene.
What is the SMILES notation for 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene?
The canonical SMILES for 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene is BrCCC1(CCBr)c2cc(Br)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene?
The InChIKey is XMPMJNYWWVUWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Br4/c18-7-5-17(6-8-19)15-9-11(20)1-3-13(15)14-4-2-12(21)10-16(14)17/h1-4,9-10H,5-8H2.
What are the key properties of 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene?
2,7-dibromo-9,9-bis(2-bromoethyl)fluorene has a molecular weight of 537.92 g/mol, XLogP of 7.05, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-bis(2-bromoethyl)fluorene is sourced from PubChem (CID 68813933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).