C16H6Br2F6O — CID 178176795
3,6-dibromo-10,10-bis(trifluoromethyl)anthracen-9-one (PubChem CID 178176795) has the molecular formula C16H6Br2F6O and a molecular weight of 488.02 g/mol. Its IUPAC name is 3,6-dibromo-10,10-bis(trifluoromethyl)anthracen-9-one.
| Compound Name | 3,6-dibromo-10,10-bis(trifluoromethyl)anthracen-9-one |
|---|---|
| PubChem CID | 178176795 |
| Molecular Formula | C16H6Br2F6O |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 485.87 |
| IUPAC Name | 3,6-dibromo-10,10-bis(trifluoromethyl)anthracen-9-one |
| SMILES | O=C1c2ccc(Br)cc2C(C(F)(F)F)(C(F)(F)F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C16H6Br2F6O/c17-7-1-3-9-11(5-7)14(15(19,20)21,16(22,23)24)12-6-8(18)2-4-10(12)13(9)25/h1-6H |
| InChIKey | BXPLXKZCRITWEU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |