C24H16Br2F6O — CID 178176785
3,6-dibromo-9-(2,5-dimethylphenyl)-10,10-bis(trifluoromethyl)anthracen-9-ol (PubChem CID 178176785) has the molecular formula C24H16Br2F6O and a molecular weight of 594.19 g/mol. Its IUPAC name is 3,6-dibromo-9-(2,5-dimethylphenyl)-10,10-bis(trifluoromethyl)anthracen-9-ol.
| Compound Name | 3,6-dibromo-9-(2,5-dimethylphenyl)-10,10-bis(trifluoromethyl)anthracen-9-ol |
|---|---|
| PubChem CID | 178176785 |
| Molecular Formula | C24H16Br2F6O |
| Molecular Weight | 594.19 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | 3,6-dibromo-9-(2,5-dimethylphenyl)-10,10-bis(trifluoromethyl)anthracen-9-ol |
| SMILES | Cc1ccc(C)c(C2(O)c3ccc(Br)cc3C(C(F)(F)F)(C(F)(F)F)c3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C24H16Br2F6O/c1-12-3-4-13(2)18(9-12)21(33)16-7-5-14(25)10-19(16)22(23(27,28)29,24(30,31)32)20-11-15(26)6-8-17(20)21/h3-11,33H,1-2H3 |
| InChIKey | GWIMZKMUDVUYAX-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.19 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |