C13H15BrO — CID 10858443
2-bromo-1-(2,5-dimethylphenyl)cyclopent-2-en-1-ol (PubChem CID 10858443) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is 2-bromo-1-(2,5-dimethylphenyl)cyclopent-2-en-1-ol.
| Compound Name | 2-bromo-1-(2,5-dimethylphenyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10858443 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-bromo-1-(2,5-dimethylphenyl)cyclopent-2-en-1-ol |
| SMILES | Cc1ccc(C)c(C2(O)CCC=C2Br)c1 |
| InChI | InChI=1S/C13H15BrO/c1-9-5-6-10(2)11(8-9)13(15)7-3-4-12(13)14/h4-6,8,15H,3,7H2,1-2H3 |
| InChIKey | XYSUMVCILSZRDH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |