C14H19Br — CID 116540790
2-(3-bromo-1-methylcyclopentyl)-1,4-dimethylbenzene (PubChem CID 116540790) has the molecular formula C14H19Br and a molecular weight of 267.21 g/mol. Its IUPAC name is 2-(3-bromo-1-methylcyclopentyl)-1,4-dimethylbenzene.
| Compound Name | 2-(3-bromo-1-methylcyclopentyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 116540790 |
| Molecular Formula | C14H19Br |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(3-bromo-1-methylcyclopentyl)-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C2(C)CCC(Br)C2)c1 |
| InChI | InChI=1S/C14H19Br/c1-10-4-5-11(2)13(8-10)14(3)7-6-12(15)9-14/h4-5,8,12H,6-7,9H2,1-3H3 |
| InChIKey | LVVDEUZNGOYPJP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|