C15H22O — CID 79863052
1-(2,5-dimethylphenyl)-2,2-dimethylcyclopentan-1-ol (PubChem CID 79863052) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2,2-dimethylcyclopentan-1-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-2,2-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 79863052 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2,2-dimethylcyclopentan-1-ol |
| SMILES | Cc1ccc(C)c(C2(O)CCCC2(C)C)c1 |
| InChI | InChI=1S/C15H22O/c1-11-6-7-12(2)13(10-11)15(16)9-5-8-14(15,3)4/h6-7,10,16H,5,8-9H2,1-4H3 |
| InChIKey | AAHMRFVRORWTPZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |