C14H19NO — CID 66107823
4-(2,5-dimethylphenyl)-4,5-dimethylpyrrolidin-2-one (PubChem CID 66107823) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-4,5-dimethylpyrrolidin-2-one.
| Compound Name | 4-(2,5-dimethylphenyl)-4,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 66107823 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-4,5-dimethylpyrrolidin-2-one |
| SMILES | Cc1ccc(C)c(C2(C)CC(=O)NC2C)c1 |
| InChI | InChI=1S/C14H19NO/c1-9-5-6-10(2)12(7-9)14(4)8-13(16)15-11(14)3/h5-7,11H,8H2,1-4H3,(H,15,16) |
| InChIKey | MOWDTIRHOHGXKF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |