C14H21N — CID 82491829
[1-(2,5-dimethylphenyl)cyclopentyl]methanamine (PubChem CID 82491829) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)cyclopentyl]methanamine.
| Compound Name | [1-(2,5-dimethylphenyl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 82491829 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | [1-(2,5-dimethylphenyl)cyclopentyl]methanamine |
| SMILES | Cc1ccc(C)c(C2(CN)CCCC2)c1 |
| InChI | InChI=1S/C14H21N/c1-11-5-6-12(2)13(9-11)14(10-15)7-3-4-8-14/h5-6,9H,3-4,7-8,10,15H2,1-2H3 |
| InChIKey | DSEZWURUPKVTMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |