C12H17NO — CID 82604285
2-[1-(aminomethyl)cyclobutyl]-5-methylphenol (PubChem CID 82604285) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclobutyl]-5-methylphenol.
| Compound Name | 2-[1-(aminomethyl)cyclobutyl]-5-methylphenol |
|---|---|
| PubChem CID | 82604285 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-[1-(aminomethyl)cyclobutyl]-5-methylphenol |
| SMILES | Cc1ccc(C2(CN)CCC2)c(O)c1 |
| InChI | InChI=1S/C12H17NO/c1-9-3-4-10(11(14)7-9)12(8-13)5-2-6-12/h3-4,7,14H,2,5-6,8,13H2,1H3 |
| InChIKey | RELMOIWRNNDOQJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |