C28H20Br2O — CID 142288098
3,6-bis(4-bromophenyl)-10,10-dimethylanthracen-9-one (PubChem CID 142288098) has the molecular formula C28H20Br2O and a molecular weight of 532.28 g/mol. Its IUPAC name is 3,6-bis(4-bromophenyl)-10,10-dimethylanthracen-9-one.
| Compound Name | 3,6-bis(4-bromophenyl)-10,10-dimethylanthracen-9-one |
|---|---|
| PubChem CID | 142288098 |
| Molecular Formula | C28H20Br2O |
| Molecular Weight | 532.28 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | 3,6-bis(4-bromophenyl)-10,10-dimethylanthracen-9-one |
| SMILES | CC1(C)c2cc(-c3ccc(Br)cc3)ccc2C(=O)c2ccc(-c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C28H20Br2O/c1-28(2)25-15-19(17-3-9-21(29)10-4-17)7-13-23(25)27(31)24-14-8-20(16-26(24)28)18-5-11-22(30)12-6-18/h3-16H,1-2H3 |
| InChIKey | IMAQIKHMGWDNQO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.28 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |