C27H18Br4O — CID 161169135
3,6-dibromo-9H-fluorene;3,6-dibromofluoren-9-one;methane (PubChem CID 161169135) has the molecular formula C27H18Br4O and a molecular weight of 678.06 g/mol. Its IUPAC name is 3,6-dibromo-9H-fluorene;3,6-dibromofluoren-9-one;methane.
| Compound Name | 3,6-dibromo-9H-fluorene;3,6-dibromofluoren-9-one;methane |
|---|---|
| PubChem CID | 161169135 |
| Molecular Formula | C27H18Br4O |
| Molecular Weight | 678.06 g/mol |
| Exact Mass | 673.81 |
| IUPAC Name | 3,6-dibromo-9H-fluorene;3,6-dibromofluoren-9-one;methane |
| SMILES | Brc1ccc2c(c1)-c1cc(Br)ccc1C2.C.O=C1c2ccc(Br)cc2-c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H6Br2O.C13H8Br2.CH4/c14-7-1-3-9-11(5-7)12-6-8(15)2-4-10(12)13(9)16;14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;/h1-6H;1-4,6-7H,5H2;1H4 |
| InChIKey | UQYHFGTURCSXOK-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.06 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |