C32H32Br6 — CID 137443816
2,8-dibromo-6,6,12,12-tetrakis(3-bromopropyl)indeno[1,2-b]fluorene (PubChem CID 137443816) has the molecular formula C32H32Br6 and a molecular weight of 896.03 g/mol. Its IUPAC name is 2,8-dibromo-6,6,12,12-tetrakis(3-bromopropyl)indeno[1,2-b]fluorene.
| Compound Name | 2,8-dibromo-6,6,12,12-tetrakis(3-bromopropyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 137443816 |
| Molecular Formula | C32H32Br6 |
| Molecular Weight | 896.03 g/mol |
| Exact Mass | 889.76 |
| IUPAC Name | 2,8-dibromo-6,6,12,12-tetrakis(3-bromopropyl)indeno[1,2-b]fluorene |
| SMILES | BrCCCC1(CCCBr)c2cc(Br)ccc2-c2cc3c(cc21)-c1ccc(Br)cc1C3(CCCBr)CCCBr |
| InChI | InChI=1S/C32H32Br6/c33-13-1-9-31(10-2-14-34)27-17-21(37)5-7-23(27)25-20-30-26(19-29(25)31)24-8-6-22(38)18-28(24)32(30,11-3-15-35)12-4-16-36/h5-8,17-20H,1-4,9-16H2 |
| InChIKey | SACOTOXLWAWUKS-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.03 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|