C25H32Br2O2 — CID 86231316
6-[2,7-dibromo-9-(6-hydroxyhexyl)fluoren-9-yl]hexan-1-ol (PubChem CID 86231316) has the molecular formula C25H32Br2O2 and a molecular weight of 524.34 g/mol. Its IUPAC name is 6-[2,7-dibromo-9-(6-hydroxyhexyl)fluoren-9-yl]hexan-1-ol.
| Compound Name | 6-[2,7-dibromo-9-(6-hydroxyhexyl)fluoren-9-yl]hexan-1-ol |
|---|---|
| PubChem CID | 86231316 |
| Molecular Formula | C25H32Br2O2 |
| Molecular Weight | 524.34 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 6-[2,7-dibromo-9-(6-hydroxyhexyl)fluoren-9-yl]hexan-1-ol |
| SMILES | OCCCCCCC1(CCCCCCO)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H32Br2O2/c26-19-9-11-21-22-12-10-20(27)18-24(22)25(23(21)17-19,13-5-1-3-7-15-28)14-6-2-4-8-16-29/h9-12,17-18,28-29H,1-8,13-16H2 |
| InChIKey | VYPKIFLMGREFQP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.34 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|