C27H32Br2O4 — CID 171578928
2-[4-[2,7-dibromo-9-[4-(1,3-dioxolan-2-yl)butyl]fluoren-9-yl]butyl]-1,3-dioxolane (PubChem CID 171578928) has the molecular formula C27H32Br2O4 and a molecular weight of 580.36 g/mol. Its IUPAC name is 2-[4-[2,7-dibromo-9-[4-(1,3-dioxolan-2-yl)butyl]fluoren-9-yl]butyl]-1,3-dioxolane.
| Compound Name | 2-[4-[2,7-dibromo-9-[4-(1,3-dioxolan-2-yl)butyl]fluoren-9-yl]butyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 171578928 |
| Molecular Formula | C27H32Br2O4 |
| Molecular Weight | 580.36 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | 2-[4-[2,7-dibromo-9-[4-(1,3-dioxolan-2-yl)butyl]fluoren-9-yl]butyl]-1,3-dioxolane |
| SMILES | Brc1ccc2c(c1)C(CCCCC1OCCO1)(CCCCC1OCCO1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C27H32Br2O4/c28-19-7-9-21-22-10-8-20(29)18-24(22)27(23(21)17-19,11-3-1-5-25-30-13-14-31-25)12-4-2-6-26-32-15-16-33-26/h7-10,17-18,25-26H,1-6,11-16H2 |
| InChIKey | IHKRSKDDERUILZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.36 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|