C25H32Br2O4 — CID 58473533
2,7-dibromo-9,9-bis[3-(2-methoxyethoxy)propyl]fluorene (PubChem CID 58473533) has the molecular formula C25H32Br2O4 and a molecular weight of 556.34 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis[3-(2-methoxyethoxy)propyl]fluorene.
| Compound Name | 2,7-dibromo-9,9-bis[3-(2-methoxyethoxy)propyl]fluorene |
|---|---|
| PubChem CID | 58473533 |
| Molecular Formula | C25H32Br2O4 |
| Molecular Weight | 556.34 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2,7-dibromo-9,9-bis[3-(2-methoxyethoxy)propyl]fluorene |
| SMILES | COCCOCCCC1(CCCOCCOC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H32Br2O4/c1-28-13-15-30-11-3-9-25(10-4-12-31-16-14-29-2)23-17-19(26)5-7-21(23)22-8-6-20(27)18-24(22)25/h5-8,17-18H,3-4,9-16H2,1-2H3 |
| InChIKey | DWDPYDABHZTDKG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.34 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|