C18H18Br2O2 — CID 90399566
2-[2,7-dibromo-9-(2-methoxyethyl)fluoren-9-yl]ethanol (PubChem CID 90399566) has the molecular formula C18H18Br2O2 and a molecular weight of 426.15 g/mol. Its IUPAC name is 2-[2,7-dibromo-9-(2-methoxyethyl)fluoren-9-yl]ethanol.
| Compound Name | 2-[2,7-dibromo-9-(2-methoxyethyl)fluoren-9-yl]ethanol |
|---|---|
| PubChem CID | 90399566 |
| Molecular Formula | C18H18Br2O2 |
| Molecular Weight | 426.15 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | 2-[2,7-dibromo-9-(2-methoxyethyl)fluoren-9-yl]ethanol |
| SMILES | COCCC1(CCO)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C18H18Br2O2/c1-22-9-7-18(6-8-21)16-10-12(19)2-4-14(16)15-5-3-13(20)11-17(15)18/h2-5,10-11,21H,6-9H2,1H3 |
| InChIKey | RHIOOKZIOOIOPY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.15 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |