C27H36Br2O6 — CID 102112341
2,7-dibromo-9,9-bis[1-[2-(2-methoxyethoxy)ethoxy]ethyl]fluorene (PubChem CID 102112341) has the molecular formula C27H36Br2O6 and a molecular weight of 616.39 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis[1-[2-(2-methoxyethoxy)ethoxy]ethyl]fluorene.
| Compound Name | 2,7-dibromo-9,9-bis[1-[2-(2-methoxyethoxy)ethoxy]ethyl]fluorene |
|---|---|
| PubChem CID | 102112341 |
| Molecular Formula | C27H36Br2O6 |
| Molecular Weight | 616.39 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 2,7-dibromo-9,9-bis[1-[2-(2-methoxyethoxy)ethoxy]ethyl]fluorene |
| SMILES | COCCOCCOC(C)C1(C(C)OCCOCCOC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C27H36Br2O6/c1-19(34-15-13-32-11-9-30-3)27(20(2)35-16-14-33-12-10-31-4)25-17-21(28)5-7-23(25)24-8-6-22(29)18-26(24)27/h5-8,17-20H,9-16H2,1-4H3 |
| InChIKey | GHUDQJDZTFVZHY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|