C20H14Br2O2 — CID 90251029
2,7-dibromo-9-(3-methoxyphenyl)fluoren-9-ol (PubChem CID 90251029) has the molecular formula C20H14Br2O2 and a molecular weight of 446.14 g/mol. Its IUPAC name is 2,7-dibromo-9-(3-methoxyphenyl)fluoren-9-ol.
| Compound Name | 2,7-dibromo-9-(3-methoxyphenyl)fluoren-9-ol |
|---|---|
| PubChem CID | 90251029 |
| Molecular Formula | C20H14Br2O2 |
| Molecular Weight | 446.14 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | 2,7-dibromo-9-(3-methoxyphenyl)fluoren-9-ol |
| SMILES | COc1cccc(C2(O)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C20H14Br2O2/c1-24-15-4-2-3-12(9-15)20(23)18-10-13(21)5-7-16(18)17-8-6-14(22)11-19(17)20/h2-11,23H,1H3 |
| InChIKey | XRPOHDLUFTVBQH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.14 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |