C16H19F3O4S — CID 118325079
(7-tert-butyl-2,2-dimethylchromen-4-yl) trifluoromethanesulfonate (PubChem CID 118325079) has the molecular formula C16H19F3O4S and a molecular weight of 364.39 g/mol. Its IUPAC name is (7-tert-butyl-2,2-dimethylchromen-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-tert-butyl-2,2-dimethylchromen-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118325079 |
| Molecular Formula | C16H19F3O4S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (7-tert-butyl-2,2-dimethylchromen-4-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)C=C(OS(=O)(=O)C(F)(F)F)c2ccc(C(C)(C)C)cc2O1 |
| InChI | InChI=1S/C16H19F3O4S/c1-14(2,3)10-6-7-11-12(8-10)22-15(4,5)9-13(11)23-24(20,21)16(17,18)19/h6-9H,1-5H3 |
| InChIKey | KGISWXQCEWPVLW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|