C13H14F3NO5S — CID 10594204
(7-ethoxy-2,2-dimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate (PubChem CID 10594204) has the molecular formula C13H14F3NO5S and a molecular weight of 353.32 g/mol. Its IUPAC name is (7-ethoxy-2,2-dimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-ethoxy-2,2-dimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10594204 |
| Molecular Formula | C13H14F3NO5S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (7-ethoxy-2,2-dimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate |
| SMILES | CCOc1ccc2c(c1)OC(C)(C)N=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO5S/c1-4-20-8-5-6-9-10(7-8)21-12(2,3)17-11(9)22-23(18,19)13(14,15)16/h5-7H,4H2,1-3H3 |
| InChIKey | HJFWQEVRXVBLML-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|