C13H13F3O4S — CID 101273068
(2,2,6-trimethylchromen-4-yl) trifluoromethanesulfonate (PubChem CID 101273068) has the molecular formula C13H13F3O4S and a molecular weight of 322.30 g/mol. Its IUPAC name is (2,2,6-trimethylchromen-4-yl) trifluoromethanesulfonate.
| Compound Name | (2,2,6-trimethylchromen-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101273068 |
| Molecular Formula | C13H13F3O4S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (2,2,6-trimethylchromen-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(c1)C(OS(=O)(=O)C(F)(F)F)=CC(C)(C)O2 |
| InChI | InChI=1S/C13H13F3O4S/c1-8-4-5-10-9(6-8)11(7-12(2,3)19-10)20-21(17,18)13(14,15)16/h4-7H,1-3H3 |
| InChIKey | QNIBJIDHZAXPIR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|