C18H18F3NO4S — CID 167216248
N-(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl)oxy-N-(trifluoromethylsulfanyl)hydroxylamine (PubChem CID 167216248) has the molecular formula C18H18F3NO4S and a molecular weight of 401.41 g/mol. Its IUPAC name is N-(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl)oxy-N-(trifluoromethylsulfanyl)hydroxylamine.
| Compound Name | N-(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl)oxy-N-(trifluoromethylsulfanyl)hydroxylamine |
|---|---|
| PubChem CID | 167216248 |
| Molecular Formula | C18H18F3NO4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl)oxy-N-(trifluoromethylsulfanyl)hydroxylamine |
| SMILES | COc1cc(ON(O)SC(F)(F)F)cc2c1-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C18H18F3NO4S/c1-10-5-6-13-12(7-10)16-14(24-4)8-11(9-15(16)25-17(13,2)3)26-22(23)27-18(19,20)21/h5-9,23H,1-4H3 |
| InChIKey | BKZFKDXJOYYTQV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|