C15H17F3O3S — CID 543872
[3,5-bis(1-methylcyclopropyl)phenyl] trifluoromethanesulfonate (PubChem CID 543872) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is [3,5-bis(1-methylcyclopropyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-bis(1-methylcyclopropyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 543872 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [3,5-bis(1-methylcyclopropyl)phenyl] trifluoromethanesulfonate |
| SMILES | CC1(c2cc(OS(=O)(=O)C(F)(F)F)cc(C3(C)CC3)c2)CC1 |
| InChI | InChI=1S/C15H17F3O3S/c1-13(3-4-13)10-7-11(14(2)5-6-14)9-12(8-10)21-22(19,20)15(16,17)18/h7-9H,3-6H2,1-2H3 |
| InChIKey | OPQMTIQVAYMIGO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|