C8H9F3O3S — CID 11032051
cyclohepta-1,6-dien-1-yl trifluoromethanesulfonate (PubChem CID 11032051) has the molecular formula C8H9F3O3S and a molecular weight of 242.22 g/mol. Its IUPAC name is cyclohepta-1,6-dien-1-yl trifluoromethanesulfonate.
| Compound Name | cyclohepta-1,6-dien-1-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11032051 |
| Molecular Formula | C8H9F3O3S |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | cyclohepta-1,6-dien-1-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCCCC=C1)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O3S/c9-8(10,11)15(12,13)14-7-5-3-1-2-4-6-7/h3,5-6H,1-2,4H2 |
| InChIKey | NRQGTQINKXRJOZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|