C13H12F6O6S2 — CID 102574213
[(8aS)-8a-methyl-6-(trifluoromethylsulfonyloxy)-4,8-dihydro-3H-naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 102574213) has the molecular formula C13H12F6O6S2 and a molecular weight of 442.36 g/mol. Its IUPAC name is [(8aS)-8a-methyl-6-(trifluoromethylsulfonyloxy)-4,8-dihydro-3H-naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(8aS)-8a-methyl-6-(trifluoromethylsulfonyloxy)-4,8-dihydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102574213 |
| Molecular Formula | C13H12F6O6S2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | [(8aS)-8a-methyl-6-(trifluoromethylsulfonyloxy)-4,8-dihydro-3H-naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CC=C(OS(=O)(=O)C(F)(F)F)C=C1CCC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F6O6S2/c1-11-6-5-9(24-26(20,21)12(14,15)16)7-8(11)3-2-4-10(11)25-27(22,23)13(17,18)19/h4-5,7H,2-3,6H2,1H3/t11-/m0/s1 |
| InChIKey | WXWXDXWUVYZLEJ-NSHDSACASA-N |
| XLogP | 3.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|