C11H15F3O5S — CID 10567393
(6,6-dimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl) trifluoromethanesulfonate (PubChem CID 10567393) has the molecular formula C11H15F3O5S and a molecular weight of 316.30 g/mol. Its IUPAC name is (6,6-dimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl) trifluoromethanesulfonate.
| Compound Name | (6,6-dimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10567393 |
| Molecular Formula | C11H15F3O5S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (6,6-dimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl) trifluoromethanesulfonate |
| SMILES | CC1(C)C(OS(=O)(=O)C(F)(F)F)=CCCC12OCCO2 |
| InChI | InChI=1S/C11H15F3O5S/c1-9(2)8(19-20(15,16)11(12,13)14)4-3-5-10(9)17-6-7-18-10/h4H,3,5-7H2,1-2H3 |
| InChIKey | LMIGORZQCGCZCP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|