C16H23F3O6S — CID 71697991
[(3'aS,5'R,7'aS)-7'a-(3-hydroxypropyl)-5'-methylspiro[1,3-dioxolane-2,7'-3a,4,5,6-tetrahydro-3H-indene]-1'-yl] trifluoromethanesulfonate (PubChem CID 71697991) has the molecular formula C16H23F3O6S and a molecular weight of 400.42 g/mol. Its IUPAC name is [(3'aS,5'R,7'aS)-7'a-(3-hydroxypropyl)-5'-methylspiro[1,3-dioxolane-2,7'-3a,4,5,6-tetrahydro-3H-indene]-1'-yl] trifluoromethanesulfonate.
| Compound Name | [(3'aS,5'R,7'aS)-7'a-(3-hydroxypropyl)-5'-methylspiro[1,3-dioxolane-2,7'-3a,4,5,6-tetrahydro-3H-indene]-1'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71697991 |
| Molecular Formula | C16H23F3O6S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(3'aS,5'R,7'aS)-7'a-(3-hydroxypropyl)-5'-methylspiro[1,3-dioxolane-2,7'-3a,4,5,6-tetrahydro-3H-indene]-1'-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1C[C@H]2CC=C(OS(=O)(=O)C(F)(F)F)[C@@]2(CCCO)C2(C1)OCCO2 |
| InChI | InChI=1S/C16H23F3O6S/c1-11-9-12-3-4-13(25-26(21,22)16(17,18)19)14(12,5-2-6-20)15(10-11)23-7-8-24-15/h4,11-12,20H,2-3,5-10H2,1H3/t11-,12-,14+/m1/s1 |
| InChIKey | TZVGLOFXXKGJNA-BZPMIXESSA-N |
| XLogP | 2.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|