C23H25F3O5S — CID 135076706
[6,6-bis[(2-methoxyphenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 135076706) has the molecular formula C23H25F3O5S and a molecular weight of 470.51 g/mol. Its IUPAC name is [6,6-bis[(2-methoxyphenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [6,6-bis[(2-methoxyphenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135076706 |
| Molecular Formula | C23H25F3O5S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | [6,6-bis[(2-methoxyphenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | COc1ccccc1CC1(Cc2ccccc2OC)CCCC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C23H25F3O5S/c1-29-19-11-5-3-9-17(19)15-22(16-18-10-4-6-12-20(18)30-2)14-8-7-13-21(22)31-32(27,28)23(24,25)26/h3-6,9-13H,7-8,14-16H2,1-2H3 |
| InChIKey | SSKARPILUPHMTB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|