C17H18BrF3O5S — CID 14900173
ethyl 1-[(2-bromophenyl)methyl]-2-(trifluoromethylsulfonyloxy)cyclohex-2-ene-1-carboxylate (PubChem CID 14900173) has the molecular formula C17H18BrF3O5S and a molecular weight of 471.29 g/mol. Its IUPAC name is ethyl 1-[(2-bromophenyl)methyl]-2-(trifluoromethylsulfonyloxy)cyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 1-[(2-bromophenyl)methyl]-2-(trifluoromethylsulfonyloxy)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 14900173 |
| Molecular Formula | C17H18BrF3O5S |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | ethyl 1-[(2-bromophenyl)methyl]-2-(trifluoromethylsulfonyloxy)cyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2Br)CCCC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H18BrF3O5S/c1-2-25-15(22)16(11-12-7-3-4-8-13(12)18)10-6-5-9-14(16)26-27(23,24)17(19,20)21/h3-4,7-9H,2,5-6,10-11H2,1H3 |
| InChIKey | XFILVSGHONYNHP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|