C25H28F3NO5S — CID 135076707
ethyl 3,3-bis[(2-methylphenyl)methyl]-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate (PubChem CID 135076707) has the molecular formula C25H28F3NO5S and a molecular weight of 511.56 g/mol. Its IUPAC name is ethyl 3,3-bis[(2-methylphenyl)methyl]-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate.
| Compound Name | ethyl 3,3-bis[(2-methylphenyl)methyl]-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 135076707 |
| Molecular Formula | C25H28F3NO5S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | ethyl 3,3-bis[(2-methylphenyl)methyl]-4-(trifluoromethylsulfonyloxy)-2,6-dihydropyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=C(OS(=O)(=O)C(F)(F)F)C(Cc2ccccc2C)(Cc2ccccc2C)C1 |
| InChI | InChI=1S/C25H28F3NO5S/c1-4-33-23(30)29-14-13-22(34-35(31,32)25(26,27)28)24(17-29,15-20-11-7-5-9-18(20)2)16-21-12-8-6-10-19(21)3/h5-13H,4,14-17H2,1-3H3 |
| InChIKey | ZILVNXYYLOJBAI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|