C21H19F5O3S — CID 135076854
[6,6-bis[(3-fluorophenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 135076854) has the molecular formula C21H19F5O3S and a molecular weight of 446.44 g/mol. Its IUPAC name is [6,6-bis[(3-fluorophenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [6,6-bis[(3-fluorophenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135076854 |
| Molecular Formula | C21H19F5O3S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [6,6-bis[(3-fluorophenyl)methyl]cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1=CCCCC1(Cc1cccc(F)c1)Cc1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C21H19F5O3S/c22-17-7-3-5-15(11-17)13-20(14-16-6-4-8-18(23)12-16)10-2-1-9-19(20)29-30(27,28)21(24,25)26/h3-9,11-12H,1-2,10,13-14H2 |
| InChIKey | NOTKQDCYUCHRNK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|