C14H10BrF4NO4S — CID 21035314
[3-bromo-1-[(3-fluorophenyl)methyl]-6-methyl-2-oxo-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 21035314) has the molecular formula C14H10BrF4NO4S and a molecular weight of 444.20 g/mol. Its IUPAC name is [3-bromo-1-[(3-fluorophenyl)methyl]-6-methyl-2-oxo-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [3-bromo-1-[(3-fluorophenyl)methyl]-6-methyl-2-oxo-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21035314 |
| Molecular Formula | C14H10BrF4NO4S |
| Molecular Weight | 444.20 g/mol |
| Exact Mass | 442.95 |
| IUPAC Name | [3-bromo-1-[(3-fluorophenyl)methyl]-6-methyl-2-oxo-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)c(Br)c(=O)n1Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H10BrF4NO4S/c1-8-5-11(24-25(22,23)14(17,18)19)12(15)13(21)20(8)7-9-3-2-4-10(16)6-9/h2-6H,7H2,1H3 |
| InChIKey | IDZSBRBEQBQBSE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|