C20H17BrF2N2O2 — CID 22050290
1-[(3-aminophenyl)methyl]-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one (PubChem CID 22050290) has the molecular formula C20H17BrF2N2O2 and a molecular weight of 435.27 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one.
| Compound Name | 1-[(3-aminophenyl)methyl]-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 22050290 |
| Molecular Formula | C20H17BrF2N2O2 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1cccc(N)c1 |
| InChI | InChI=1S/C20H17BrF2N2O2/c1-12-7-18(27-11-14-5-6-15(22)9-17(14)23)19(21)20(26)25(12)10-13-3-2-4-16(24)8-13/h2-9H,10-11,24H2,1H3 |
| InChIKey | YOJUVPNDCZWFID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|