C19H15BrClF2N3O2 — CID 22051169
3-bromo-1-[[5-(chloromethyl)pyrazin-2-yl]methyl]-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one (PubChem CID 22051169) has the molecular formula C19H15BrClF2N3O2 and a molecular weight of 470.70 g/mol. Its IUPAC name is 3-bromo-1-[[5-(chloromethyl)pyrazin-2-yl]methyl]-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one.
| Compound Name | 3-bromo-1-[[5-(chloromethyl)pyrazin-2-yl]methyl]-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 22051169 |
| Molecular Formula | C19H15BrClF2N3O2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 3-bromo-1-[[5-(chloromethyl)pyrazin-2-yl]methyl]-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1cnc(CCl)cn1 |
| InChI | InChI=1S/C19H15BrClF2N3O2/c1-11-4-17(28-10-12-2-3-13(22)5-16(12)23)18(20)19(27)26(11)9-15-8-24-14(6-21)7-25-15/h2-5,7-8H,6,9-10H2,1H3 |
| InChIKey | YYWRKEQKRIJDBF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|