C23H23BrF2N2O3 — CID 22050789
3-bromo-4-[(2,4-difluorophenyl)methoxy]-1-[[3-[(2-hydroxyethylamino)methyl]phenyl]methyl]-6-methylpyridin-2-one (PubChem CID 22050789) has the molecular formula C23H23BrF2N2O3 and a molecular weight of 493.35 g/mol. Its IUPAC name is 3-bromo-4-[(2,4-difluorophenyl)methoxy]-1-[[3-[(2-hydroxyethylamino)methyl]phenyl]methyl]-6-methylpyridin-2-one.
| Compound Name | 3-bromo-4-[(2,4-difluorophenyl)methoxy]-1-[[3-[(2-hydroxyethylamino)methyl]phenyl]methyl]-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 22050789 |
| Molecular Formula | C23H23BrF2N2O3 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 3-bromo-4-[(2,4-difluorophenyl)methoxy]-1-[[3-[(2-hydroxyethylamino)methyl]phenyl]methyl]-6-methylpyridin-2-one |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1cccc(CNCCO)c1 |
| InChI | InChI=1S/C23H23BrF2N2O3/c1-15-9-21(31-14-18-5-6-19(25)11-20(18)26)22(24)23(30)28(15)13-17-4-2-3-16(10-17)12-27-7-8-29/h2-6,9-11,27,29H,7-8,12-14H2,1H3 |
| InChIKey | RHIYYOQCRBLTAF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|