C19H15BrClF3N2O2 — CID 22050202
1-(5-amino-2-fluorophenyl)-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one;hydrochloride (PubChem CID 22050202) has the molecular formula C19H15BrClF3N2O2 and a molecular weight of 475.69 g/mol. Its IUPAC name is 1-(5-amino-2-fluorophenyl)-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one;hydrochloride.
| Compound Name | 1-(5-amino-2-fluorophenyl)-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 22050202 |
| Molecular Formula | C19H15BrClF3N2O2 |
| Molecular Weight | 475.69 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | 1-(5-amino-2-fluorophenyl)-3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methylpyridin-2-one;hydrochloride |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1-c1cc(N)ccc1F.Cl |
| InChI | InChI=1S/C19H14BrF3N2O2.ClH/c1-10-6-17(27-9-11-2-3-12(21)7-15(11)23)18(20)19(26)25(10)16-8-13(24)4-5-14(16)22;/h2-8H,9,24H2,1H3;1H |
| InChIKey | FYNJENHSOONYQD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|