C19H14BF3N2O2 — CID 89134455
CID 89134455 (PubChem CID 89134455) has the molecular formula C19H14BF3N2O2 and a molecular weight of 370.14 g/mol.
| Compound Name | CID 89134455 |
|---|---|
| PubChem CID | 89134455 |
| Molecular Formula | C19H14BF3N2O2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | — |
| SMILES | [B]c1c(OCc2ccc(F)cc2F)cc(C)n(-c2cc(N)ccc2F)c1=O |
| InChI | InChI=1S/C19H14BF3N2O2/c1-10-6-17(27-9-11-2-3-12(21)7-15(11)23)18(20)19(26)25(10)16-8-13(24)4-5-14(16)22/h2-8H,9,24H2,1H3 |
| InChIKey | OXTCTNMLAYFXAJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|