C21H14BF4NO2 — CID 89134151
CID 89134151 (PubChem CID 89134151) has the molecular formula C21H14BF4NO2 and a molecular weight of 399.15 g/mol.
| Compound Name | CID 89134151 |
|---|---|
| PubChem CID | 89134151 |
| Molecular Formula | C21H14BF4NO2 |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | — |
| SMILES | [B]c1c(OCc2ccc(F)cc2F)cc(C)n(-c2c(F)cc(C=C)cc2F)c1=O |
| InChI | InChI=1S/C21H14BF4NO2/c1-3-12-7-16(25)20(17(26)8-12)27-11(2)6-18(19(22)21(27)28)29-10-13-4-5-14(23)9-15(13)24/h3-9H,1,10H2,2H3 |
| InChIKey | SXKQCAHFQZSIJN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|