C21H14BrF4NO2 — CID 138524348
1-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2,6-difluorophenyl]-5-ethenyl-6-methylpyridin-2-one (PubChem CID 138524348) has the molecular formula C21H14BrF4NO2 and a molecular weight of 468.24 g/mol. Its IUPAC name is 1-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2,6-difluorophenyl]-5-ethenyl-6-methylpyridin-2-one.
| Compound Name | 1-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2,6-difluorophenyl]-5-ethenyl-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 138524348 |
| Molecular Formula | C21H14BrF4NO2 |
| Molecular Weight | 468.24 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | 1-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-2,6-difluorophenyl]-5-ethenyl-6-methylpyridin-2-one |
| SMILES | C=Cc1ccc(=O)n(-c2c(F)cc(OCc3ccc(F)cc3F)c(Br)c2F)c1C |
| InChI | InChI=1S/C21H14BrF4NO2/c1-3-12-5-7-18(28)27(11(12)2)21-16(25)9-17(19(22)20(21)26)29-10-13-4-6-14(23)8-15(13)24/h3-9H,1,10H2,2H3 |
| InChIKey | AVOLFGMNLGOUNZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.24 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|