C22H20BrF2NO3 — CID 142275032
(2E,3Z)-5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]-2-ethylidenehexa-3,5-dienal (PubChem CID 142275032) has the molecular formula C22H20BrF2NO3 and a molecular weight of 464.31 g/mol. Its IUPAC name is (2E,3Z)-5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]-2-ethylidenehexa-3,5-dienal.
| Compound Name | (2E,3Z)-5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]-2-ethylidenehexa-3,5-dienal |
|---|---|
| PubChem CID | 142275032 |
| Molecular Formula | C22H20BrF2NO3 |
| Molecular Weight | 464.31 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (2E,3Z)-5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]-2-ethylidenehexa-3,5-dienal |
| SMILES | C=C(/C=C\C(C=O)=C/C)Cn1c(C)cc(OCc2ccc(F)cc2F)c(Br)c1=O |
| InChI | InChI=1S/C22H20BrF2NO3/c1-4-16(12-27)6-5-14(2)11-26-15(3)9-20(21(23)22(26)28)29-13-17-7-8-18(24)10-19(17)25/h4-10,12H,2,11,13H2,1,3H3/b6-5-,16-4+ |
| InChIKey | FNIKMHCOXNBNBT-QRHXCOLQSA-N |
| XLogP | 5.03 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|