C21H21BrF2N2O3 — CID 142275027
(Z,2E)-6-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-2-ethylidenehex-3-enamide (PubChem CID 142275027) has the molecular formula C21H21BrF2N2O3 and a molecular weight of 467.31 g/mol. Its IUPAC name is (Z,2E)-6-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-2-ethylidenehex-3-enamide.
| Compound Name | (Z,2E)-6-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-2-ethylidenehex-3-enamide |
|---|---|
| PubChem CID | 142275027 |
| Molecular Formula | C21H21BrF2N2O3 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (Z,2E)-6-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]-2-ethylidenehex-3-enamide |
| SMILES | C/C=C(\C=C/CCn1c(C)cc(OCc2ccc(F)cc2F)c(Br)c1=O)C(N)=O |
| InChI | InChI=1S/C21H21BrF2N2O3/c1-3-14(20(25)27)6-4-5-9-26-13(2)10-18(19(22)21(26)28)29-12-15-7-8-16(23)11-17(15)24/h3-4,6-8,10-11H,5,9,12H2,1-2H3,(H2,25,27)/b6-4-,14-3+ |
| InChIKey | PWXYWQJUQVQGFN-VIRXMJPMSA-N |
| XLogP | 4.15 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|