C14H13F5O3S — CID 23642976
[5-[(3,5-difluorophenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate (PubChem CID 23642976) has the molecular formula C14H13F5O3S and a molecular weight of 356.31 g/mol. Its IUPAC name is [5-[(3,5-difluorophenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate.
| Compound Name | [5-[(3,5-difluorophenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23642976 |
| Molecular Formula | C14H13F5O3S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | [5-[(3,5-difluorophenyl)methyl]-5-methylcyclopenten-1-yl] trifluoromethanesulfonate |
| SMILES | CC1(Cc2cc(F)cc(F)c2)CCC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F5O3S/c1-13(8-9-5-10(15)7-11(16)6-9)4-2-3-12(13)22-23(20,21)14(17,18)19/h3,5-7H,2,4,8H2,1H3 |
| InChIKey | SYBLZDATRXRJIR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|