C17H21F3O5S — CID 11395284
methyl 1-[2-[(1R)-1-methyl-2-(trifluoromethylsulfonyloxy)cyclopent-2-en-1-yl]ethyl]cyclohexa-2,5-diene-1-carboxylate (PubChem CID 11395284) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is methyl 1-[2-[(1R)-1-methyl-2-(trifluoromethylsulfonyloxy)cyclopent-2-en-1-yl]ethyl]cyclohexa-2,5-diene-1-carboxylate.
| Compound Name | methyl 1-[2-[(1R)-1-methyl-2-(trifluoromethylsulfonyloxy)cyclopent-2-en-1-yl]ethyl]cyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 11395284 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | methyl 1-[2-[(1R)-1-methyl-2-(trifluoromethylsulfonyloxy)cyclopent-2-en-1-yl]ethyl]cyclohexa-2,5-diene-1-carboxylate |
| SMILES | COC(=O)C1(CC[C@@]2(C)CCC=C2OS(=O)(=O)C(F)(F)F)C=CCC=C1 |
| InChI | InChI=1S/C17H21F3O5S/c1-15(8-6-7-13(15)25-26(22,23)17(18,19)20)11-12-16(14(21)24-2)9-4-3-5-10-16/h4-5,7,9-10H,3,6,8,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | ISOVJWUPPVDJAQ-OAHLLOKOSA-N |
| XLogP | 3.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|